C32H28ClF4N5O4S — CID 91255785
tert-butyl (2R,4R)-2-[2-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]thieno[2,3-d]pyrimidin-6-yl]ethynyl]-4-[(2,2,2-trifluoroacetyl)amino]pyrrolidine-1-carboxylate (PubChem CID 91255785) has the molecular formula C32H28ClF4N5O4S and a molecular weight of 690.12 g/mol. Its IUPAC name is tert-butyl (2R,4R)-2-[2-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]thieno[2,3-d]pyrimidin-6-yl]ethynyl]-4-[(2,2,2-trifluoroacetyl)amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,4R)-2-[2-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]thieno[2,3-d]pyrimidin-6-yl]ethynyl]-4-[(2,2,2-trifluoroacetyl)amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 91255785 |
| Molecular Formula | C32H28ClF4N5O4S |
| Molecular Weight | 690.12 g/mol |
| Exact Mass | 689.15 |
| IUPAC Name | tert-butyl (2R,4R)-2-[2-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]thieno[2,3-d]pyrimidin-6-yl]ethynyl]-4-[(2,2,2-trifluoroacetyl)amino]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](NC(=O)C(F)(F)F)C[C@@H]1C#Cc1cc2c(Nc3ccc(OCc4cccc(F)c4)c(Cl)c3)ncnc2s1 |
| InChI | InChI=1S/C32H28ClF4N5O4S/c1-31(2,3)46-30(44)42-15-21(41-29(43)32(35,36)37)12-22(42)8-9-23-14-24-27(38-17-39-28(24)47-23)40-20-7-10-26(25(33)13-20)45-16-18-5-4-6-19(34)11-18/h4-7,10-11,13-14,17,21-22H,12,15-16H2,1-3H3,(H,41,43)(H,38,39,40)/t21-,22+/m1/s1 |
| InChIKey | PVYMVZDFPYKREX-YADHBBJMSA-N |
| XLogP | 7.21 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.12 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|