C27H22ClFN6O2 — CID 11720499
1-[[6-[2-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]pyrimidin-5-yl]ethynyl]-2-pyridinyl]methyl]-3-methylurea (PubChem CID 11720499) has the molecular formula C27H22ClFN6O2 and a molecular weight of 516.96 g/mol. Its IUPAC name is 1-[[6-[2-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]pyrimidin-5-yl]ethynyl]-2-pyridinyl]methyl]-3-methylurea.
| Compound Name | 1-[[6-[2-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]pyrimidin-5-yl]ethynyl]-2-pyridinyl]methyl]-3-methylurea |
|---|---|
| PubChem CID | 11720499 |
| Molecular Formula | C27H22ClFN6O2 |
| Molecular Weight | 516.96 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | 1-[[6-[2-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]pyrimidin-5-yl]ethynyl]-2-pyridinyl]methyl]-3-methylurea |
| SMILES | CNC(=O)NCc1cccc(C#Cc2cncnc2Nc2ccc(OCc3cccc(F)c3)c(Cl)c2)n1 |
| InChI | InChI=1S/C27H22ClFN6O2/c1-30-27(36)32-15-23-7-3-6-21(34-23)9-8-19-14-31-17-33-26(19)35-22-10-11-25(24(28)13-22)37-16-18-4-2-5-20(29)12-18/h2-7,10-14,17H,15-16H2,1H3,(H2,30,32,36)(H,31,33,35) |
| InChIKey | BIMWWEYHEVYXDA-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 101.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.96 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|