C22H33N7O2 — CID 143371559
4-[6-amino-5-[(E)-methoxyiminomethyl]pyrimidin-4-yl]-N-(4-propan-2-ylphenyl)piperazine-1-carboxamide;ethane (PubChem CID 143371559) has the molecular formula C22H33N7O2 and a molecular weight of 427.55 g/mol. Its IUPAC name is 4-[6-amino-5-[(E)-methoxyiminomethyl]pyrimidin-4-yl]-N-(4-propan-2-ylphenyl)piperazine-1-carboxamide;ethane.
| Compound Name | 4-[6-amino-5-[(E)-methoxyiminomethyl]pyrimidin-4-yl]-N-(4-propan-2-ylphenyl)piperazine-1-carboxamide;ethane |
|---|---|
| PubChem CID | 143371559 |
| Molecular Formula | C22H33N7O2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.27 |
| IUPAC Name | 4-[6-amino-5-[(E)-methoxyiminomethyl]pyrimidin-4-yl]-N-(4-propan-2-ylphenyl)piperazine-1-carboxamide;ethane |
| SMILES | CC.CO/N=C/c1c(N)ncnc1N1CCN(C(=O)Nc2ccc(C(C)C)cc2)CC1 |
| InChI | InChI=1S/C20H27N7O2.C2H6/c1-14(2)15-4-6-16(7-5-15)25-20(28)27-10-8-26(9-11-27)19-17(12-24-29-3)18(21)22-13-23-19;1-2/h4-7,12-14H,8-11H2,1-3H3,(H,25,28)(H2,21,22,23);1-2H3/b24-12+; |
| InChIKey | JQKKATROYXBVJJ-DFVQGABXSA-N |
| XLogP | 3.54 |
| TPSA | 108.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|