C24H32N6O2 — CID 91256189
4-[2-amino-3-[(Z)-methoxyiminomethyl]-4-pyridinyl]-N-(4-cyclohexylphenyl)piperazine-1-carboxamide (PubChem CID 91256189) has the molecular formula C24H32N6O2 and a molecular weight of 436.56 g/mol. Its IUPAC name is 4-[2-amino-3-[(Z)-methoxyiminomethyl]-4-pyridinyl]-N-(4-cyclohexylphenyl)piperazine-1-carboxamide.
| Compound Name | 4-[2-amino-3-[(Z)-methoxyiminomethyl]-4-pyridinyl]-N-(4-cyclohexylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 91256189 |
| Molecular Formula | C24H32N6O2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | 4-[2-amino-3-[(Z)-methoxyiminomethyl]-4-pyridinyl]-N-(4-cyclohexylphenyl)piperazine-1-carboxamide |
| SMILES | CO/N=C\c1c(N2CCN(C(=O)Nc3ccc(C4CCCCC4)cc3)CC2)ccnc1N |
| InChI | InChI=1S/C24H32N6O2/c1-32-27-17-21-22(11-12-26-23(21)25)29-13-15-30(16-14-29)24(31)28-20-9-7-19(8-10-20)18-5-3-2-4-6-18/h7-12,17-18H,2-6,13-16H2,1H3,(H2,25,26)(H,28,31)/b27-17- |
| InChIKey | OEYCPTWQTBKBRO-PKAZHMFMSA-N |
| XLogP | 4.05 |
| TPSA | 96.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|