C20H27N7O3 — CID 73175750
4-[6-amino-5-(methoxyiminomethyl)pyrimidin-4-yl]-N-(4-propan-2-yloxyphenyl)piperazine-1-carboxamide (PubChem CID 73175750) has the molecular formula C20H27N7O3 and a molecular weight of 413.48 g/mol. Its IUPAC name is 4-[6-amino-5-(methoxyiminomethyl)pyrimidin-4-yl]-N-(4-propan-2-yloxyphenyl)piperazine-1-carboxamide.
| Compound Name | 4-[6-amino-5-(methoxyiminomethyl)pyrimidin-4-yl]-N-(4-propan-2-yloxyphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 73175750 |
| Molecular Formula | C20H27N7O3 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | 4-[6-amino-5-(methoxyiminomethyl)pyrimidin-4-yl]-N-(4-propan-2-yloxyphenyl)piperazine-1-carboxamide |
| SMILES | CON=Cc1c(N)ncnc1N1CCN(C(=O)Nc2ccc(OC(C)C)cc2)CC1 |
| InChI | InChI=1S/C20H27N7O3/c1-14(2)30-16-6-4-15(5-7-16)25-20(28)27-10-8-26(9-11-27)19-17(12-24-29-3)18(21)22-13-23-19/h4-7,12-14H,8-11H2,1-3H3,(H,25,28)(H2,21,22,23) |
| InChIKey | KTIWCHBAKFOKPK-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 118.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|