C22H30ClN7O2 — CID 141459388
1-[4-[6-amino-5-(methoxyiminomethyl)pyrimidin-4-yl]piperazin-1-yl]-2-(4-chlorophenyl)-3-(propan-2-ylamino)propan-1-one (PubChem CID 141459388) has the molecular formula C22H30ClN7O2 and a molecular weight of 459.98 g/mol. Its IUPAC name is 1-[4-[6-amino-5-(methoxyiminomethyl)pyrimidin-4-yl]piperazin-1-yl]-2-(4-chlorophenyl)-3-(propan-2-ylamino)propan-1-one.
| Compound Name | 1-[4-[6-amino-5-(methoxyiminomethyl)pyrimidin-4-yl]piperazin-1-yl]-2-(4-chlorophenyl)-3-(propan-2-ylamino)propan-1-one |
|---|---|
| PubChem CID | 141459388 |
| Molecular Formula | C22H30ClN7O2 |
| Molecular Weight | 459.98 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | 1-[4-[6-amino-5-(methoxyiminomethyl)pyrimidin-4-yl]piperazin-1-yl]-2-(4-chlorophenyl)-3-(propan-2-ylamino)propan-1-one |
| SMILES | CON=Cc1c(N)ncnc1N1CCN(C(=O)C(CNC(C)C)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C22H30ClN7O2/c1-15(2)25-12-18(16-4-6-17(23)7-5-16)22(31)30-10-8-29(9-11-30)21-19(13-28-32-3)20(24)26-14-27-21/h4-7,13-15,18,25H,8-12H2,1-3H3,(H2,24,26,27) |
| InChIKey | HTSXFCURKRPPLG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 108.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.98 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|