C22H30Cl3N7O2 — CID 141459404
1-[4-[6-amino-5-(methoxyiminomethyl)pyrimidin-4-yl]piperazin-1-yl]-2-(2,4-dichlorophenyl)-3-(propan-2-ylamino)propan-1-one;hydrochloride (PubChem CID 141459404) has the molecular formula C22H30Cl3N7O2 and a molecular weight of 530.89 g/mol. Its IUPAC name is 1-[4-[6-amino-5-(methoxyiminomethyl)pyrimidin-4-yl]piperazin-1-yl]-2-(2,4-dichlorophenyl)-3-(propan-2-ylamino)propan-1-one;hydrochloride.
| Compound Name | 1-[4-[6-amino-5-(methoxyiminomethyl)pyrimidin-4-yl]piperazin-1-yl]-2-(2,4-dichlorophenyl)-3-(propan-2-ylamino)propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 141459404 |
| Molecular Formula | C22H30Cl3N7O2 |
| Molecular Weight | 530.89 g/mol |
| Exact Mass | 529.15 |
| IUPAC Name | 1-[4-[6-amino-5-(methoxyiminomethyl)pyrimidin-4-yl]piperazin-1-yl]-2-(2,4-dichlorophenyl)-3-(propan-2-ylamino)propan-1-one;hydrochloride |
| SMILES | CON=Cc1c(N)ncnc1N1CCN(C(=O)C(CNC(C)C)c2ccc(Cl)cc2Cl)CC1.Cl |
| InChI | InChI=1S/C22H29Cl2N7O2.ClH/c1-14(2)26-11-17(16-5-4-15(23)10-19(16)24)22(32)31-8-6-30(7-9-31)21-18(12-29-33-3)20(25)27-13-28-21;/h4-5,10,12-14,17,26H,6-9,11H2,1-3H3,(H2,25,27,28);1H |
| InChIKey | KAWRGBHNJCJJGI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 108.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.89 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|