C24H33Cl2N5O2 — CID 163972445
2-(2,4-dichlorophenyl)-1-[4-[(5R,7R)-7-hydroxy-5-methyl-4,5,6,7-tetrahydro-1H-cyclopenta[d]pyrimidin-4-yl]piperazin-1-yl]-3-(propan-2-ylamino)propan-1-one (PubChem CID 163972445) has the molecular formula C24H33Cl2N5O2 and a molecular weight of 494.47 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-1-[4-[(5R,7R)-7-hydroxy-5-methyl-4,5,6,7-tetrahydro-1H-cyclopenta[d]pyrimidin-4-yl]piperazin-1-yl]-3-(propan-2-ylamino)propan-1-one.
| Compound Name | 2-(2,4-dichlorophenyl)-1-[4-[(5R,7R)-7-hydroxy-5-methyl-4,5,6,7-tetrahydro-1H-cyclopenta[d]pyrimidin-4-yl]piperazin-1-yl]-3-(propan-2-ylamino)propan-1-one |
|---|---|
| PubChem CID | 163972445 |
| Molecular Formula | C24H33Cl2N5O2 |
| Molecular Weight | 494.47 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-1-[4-[(5R,7R)-7-hydroxy-5-methyl-4,5,6,7-tetrahydro-1H-cyclopenta[d]pyrimidin-4-yl]piperazin-1-yl]-3-(propan-2-ylamino)propan-1-one |
| SMILES | CC(C)NCC(C(=O)N1CCN(C2N=CNC3=C2[C@H](C)C[C@H]3O)CC1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H33Cl2N5O2/c1-14(2)27-12-18(17-5-4-16(25)11-19(17)26)24(33)31-8-6-30(7-9-31)23-21-15(3)10-20(32)22(21)28-13-29-23/h4-5,11,13-15,18,20,23,27,32H,6-10,12H2,1-3H3,(H,28,29)/t15-,18?,20-,23?/m1/s1 |
| InChIKey | SREFDKQYBCCBMR-OTJZQNOXSA-N |
| XLogP | 2.83 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.47 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |