C12H14F3N3O3 — CID 47041273
N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]morpholine-4-carboxamide (PubChem CID 47041273) has the molecular formula C12H14F3N3O3 and a molecular weight of 305.26 g/mol. Its IUPAC name is N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]morpholine-4-carboxamide.
| Compound Name | N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 47041273 |
| Molecular Formula | C12H14F3N3O3 |
| Molecular Weight | 305.26 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]morpholine-4-carboxamide |
| SMILES | O=C(Nc1ccc(OCC(F)(F)F)nc1)N1CCOCC1 |
| InChI | InChI=1S/C12H14F3N3O3/c13-12(14,15)8-21-10-2-1-9(7-16-10)17-11(19)18-3-5-20-6-4-18/h1-2,7H,3-6,8H2,(H,17,19) |
| InChIKey | UMFYQJBTAKOTPK-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.26 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |