C20H21F3N4O3 — CID 47041270
4-benzamido-N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]piperidine-1-carboxamide (PubChem CID 47041270) has the molecular formula C20H21F3N4O3 and a molecular weight of 422.41 g/mol. Its IUPAC name is 4-benzamido-N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]piperidine-1-carboxamide.
| Compound Name | 4-benzamido-N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 47041270 |
| Molecular Formula | C20H21F3N4O3 |
| Molecular Weight | 422.41 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 4-benzamido-N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]piperidine-1-carboxamide |
| SMILES | O=C(NC1CCN(C(=O)Nc2ccc(OCC(F)(F)F)nc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C20H21F3N4O3/c21-20(22,23)13-30-17-7-6-16(12-24-17)26-19(29)27-10-8-15(9-11-27)25-18(28)14-4-2-1-3-5-14/h1-7,12,15H,8-11,13H2,(H,25,28)(H,26,29) |
| InChIKey | CJLRINGHUINEQP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |