C20H26F3NOSSi — CID 140666711
N-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-4-methylsulfanyl-3-(trifluoromethyl)aniline (PubChem CID 140666711) has the molecular formula C20H26F3NOSSi and a molecular weight of 413.58 g/mol. Its IUPAC name is N-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-4-methylsulfanyl-3-(trifluoromethyl)aniline.
| Compound Name | N-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-4-methylsulfanyl-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 140666711 |
| Molecular Formula | C20H26F3NOSSi |
| Molecular Weight | 413.58 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | N-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-4-methylsulfanyl-3-(trifluoromethyl)aniline |
| SMILES | CSc1ccc(Nc2ccc(O[Si](C)(C)C(C)(C)C)cc2)cc1C(F)(F)F |
| InChI | InChI=1S/C20H26F3NOSSi/c1-19(2,3)27(5,6)25-16-10-7-14(8-11-16)24-15-9-12-18(26-4)17(13-15)20(21,22)23/h7-13,24H,1-6H3 |
| InChIKey | HFZVBQHGHNJTPT-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.58 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|