C20H28ClNO2Si — CID 142566635
N-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-(2-chloroethoxy)aniline (PubChem CID 142566635) has the molecular formula C20H28ClNO2Si and a molecular weight of 377.99 g/mol. Its IUPAC name is N-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-(2-chloroethoxy)aniline.
| Compound Name | N-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-(2-chloroethoxy)aniline |
|---|---|
| PubChem CID | 142566635 |
| Molecular Formula | C20H28ClNO2Si |
| Molecular Weight | 377.99 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | N-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-(2-chloroethoxy)aniline |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(Nc2cccc(OCCCl)c2)cc1 |
| InChI | InChI=1S/C20H28ClNO2Si/c1-20(2,3)25(4,5)24-18-11-9-16(10-12-18)22-17-7-6-8-19(15-17)23-14-13-21/h6-12,15,22H,13-14H2,1-5H3 |
| InChIKey | NRUSMIORCKKNFE-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.99 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|