C19H25NO3Si — CID 134846304
2-[3-[tert-butyl(dimethyl)silyl]oxyanilino]-5-methylcyclohexa-2,5-diene-1,4-dione (PubChem CID 134846304) has the molecular formula C19H25NO3Si and a molecular weight of 343.50 g/mol. Its IUPAC name is 2-[3-[tert-butyl(dimethyl)silyl]oxyanilino]-5-methylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[3-[tert-butyl(dimethyl)silyl]oxyanilino]-5-methylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 134846304 |
| Molecular Formula | C19H25NO3Si |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 2-[3-[tert-butyl(dimethyl)silyl]oxyanilino]-5-methylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=CC(=O)C(Nc2cccc(O[Si](C)(C)C(C)(C)C)c2)=CC1=O |
| InChI | InChI=1S/C19H25NO3Si/c1-13-10-18(22)16(12-17(13)21)20-14-8-7-9-15(11-14)23-24(5,6)19(2,3)4/h7-12,20H,1-6H3 |
| InChIKey | HJHCWXPZVUOYIR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.50 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|