C20H24ClFN2O3Si — CID 169238137
N-[[3-[tert-butyl(dimethyl)silyl]oxyphenyl]carbamoyl]-4-chloro-2-fluorobenzamide (PubChem CID 169238137) has the molecular formula C20H24ClFN2O3Si and a molecular weight of 422.96 g/mol. Its IUPAC name is N-[[3-[tert-butyl(dimethyl)silyl]oxyphenyl]carbamoyl]-4-chloro-2-fluorobenzamide.
| Compound Name | N-[[3-[tert-butyl(dimethyl)silyl]oxyphenyl]carbamoyl]-4-chloro-2-fluorobenzamide |
|---|---|
| PubChem CID | 169238137 |
| Molecular Formula | C20H24ClFN2O3Si |
| Molecular Weight | 422.96 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | N-[[3-[tert-butyl(dimethyl)silyl]oxyphenyl]carbamoyl]-4-chloro-2-fluorobenzamide |
| SMILES | CC(C)(C)[Si](C)(C)Oc1cccc(NC(=O)NC(=O)c2ccc(Cl)cc2F)c1 |
| InChI | InChI=1S/C20H24ClFN2O3Si/c1-20(2,3)28(4,5)27-15-8-6-7-14(12-15)23-19(26)24-18(25)16-10-9-13(21)11-17(16)22/h6-12H,1-5H3,(H2,23,24,25,26) |
| InChIKey | SKPHPIOVVYKHJR-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.96 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|