C20H19F4N3O4 — CID 170161493
tert-butyl-[3-[[2-fluoro-4-(trifluoromethyl)benzoyl]carbamoylamino]phenyl]carbamic acid (PubChem CID 170161493) has the molecular formula C20H19F4N3O4 and a molecular weight of 441.38 g/mol. Its IUPAC name is tert-butyl-[3-[[2-fluoro-4-(trifluoromethyl)benzoyl]carbamoylamino]phenyl]carbamic acid.
| Compound Name | tert-butyl-[3-[[2-fluoro-4-(trifluoromethyl)benzoyl]carbamoylamino]phenyl]carbamic acid |
|---|---|
| PubChem CID | 170161493 |
| Molecular Formula | C20H19F4N3O4 |
| Molecular Weight | 441.38 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | tert-butyl-[3-[[2-fluoro-4-(trifluoromethyl)benzoyl]carbamoylamino]phenyl]carbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)c1cccc(NC(=O)NC(=O)c2ccc(C(F)(F)F)cc2F)c1 |
| InChI | InChI=1S/C20H19F4N3O4/c1-19(2,3)27(18(30)31)13-6-4-5-12(10-13)25-17(29)26-16(28)14-8-7-11(9-15(14)21)20(22,23)24/h4-10H,1-3H3,(H,30,31)(H2,25,26,28,29) |
| InChIKey | YMVRPUONJCGNGA-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.38 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |