C21H13F5N2O2 — CID 134122808
2,6-difluoro-N-[[4-[4-(trifluoromethyl)phenyl]phenyl]carbamoyl]benzamide (PubChem CID 134122808) has the molecular formula C21H13F5N2O2 and a molecular weight of 420.34 g/mol. Its IUPAC name is 2,6-difluoro-N-[[4-[4-(trifluoromethyl)phenyl]phenyl]carbamoyl]benzamide.
| Compound Name | 2,6-difluoro-N-[[4-[4-(trifluoromethyl)phenyl]phenyl]carbamoyl]benzamide |
|---|---|
| PubChem CID | 134122808 |
| Molecular Formula | C21H13F5N2O2 |
| Molecular Weight | 420.34 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 2,6-difluoro-N-[[4-[4-(trifluoromethyl)phenyl]phenyl]carbamoyl]benzamide |
| SMILES | O=C(NC(=O)c1c(F)cccc1F)Nc1ccc(-c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C21H13F5N2O2/c22-16-2-1-3-17(23)18(16)19(29)28-20(30)27-15-10-6-13(7-11-15)12-4-8-14(9-5-12)21(24,25)26/h1-11H,(H2,27,28,29,30) |
| InChIKey | UAQNNPMESFSIQE-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.34 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |