C15H11ClF2N2O2 — CID 23276006
N-[(4-chloro-3-methylphenyl)carbamoyl]-2,6-difluorobenzamide (PubChem CID 23276006) has the molecular formula C15H11ClF2N2O2 and a molecular weight of 324.71 g/mol. Its IUPAC name is N-[(4-chloro-3-methylphenyl)carbamoyl]-2,6-difluorobenzamide.
| Compound Name | N-[(4-chloro-3-methylphenyl)carbamoyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 23276006 |
| Molecular Formula | C15H11ClF2N2O2 |
| Molecular Weight | 324.71 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | N-[(4-chloro-3-methylphenyl)carbamoyl]-2,6-difluorobenzamide |
| SMILES | Cc1cc(NC(=O)NC(=O)c2c(F)cccc2F)ccc1Cl |
| InChI | InChI=1S/C15H11ClF2N2O2/c1-8-7-9(5-6-10(8)16)19-15(22)20-14(21)13-11(17)3-2-4-12(13)18/h2-7H,1H3,(H2,19,20,21,22) |
| InChIKey | OQFGUJABEGAYGL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.71 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |