C15H10Cl2F2N2O3 — CID 54288472
N-[(3,5-dichloro-4-methoxyphenyl)carbamoyl]-2,6-difluorobenzamide (PubChem CID 54288472) has the molecular formula C15H10Cl2F2N2O3 and a molecular weight of 375.16 g/mol. Its IUPAC name is N-[(3,5-dichloro-4-methoxyphenyl)carbamoyl]-2,6-difluorobenzamide.
| Compound Name | N-[(3,5-dichloro-4-methoxyphenyl)carbamoyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 54288472 |
| Molecular Formula | C15H10Cl2F2N2O3 |
| Molecular Weight | 375.16 g/mol |
| Exact Mass | 374.00 |
| IUPAC Name | N-[(3,5-dichloro-4-methoxyphenyl)carbamoyl]-2,6-difluorobenzamide |
| SMILES | COc1c(Cl)cc(NC(=O)NC(=O)c2c(F)cccc2F)cc1Cl |
| InChI | InChI=1S/C15H10Cl2F2N2O3/c1-24-13-8(16)5-7(6-9(13)17)20-15(23)21-14(22)12-10(18)3-2-4-11(12)19/h2-6H,1H3,(H2,20,21,22,23) |
| InChIKey | RVVLRUUDSJFFHF-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.16 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |