C24H26Cl2F2N2O3 — CID 21285673
N-[[3,5-dichloro-4-(1-cyclohexylbutoxy)phenyl]carbamoyl]-2,6-difluorobenzamide (PubChem CID 21285673) has the molecular formula C24H26Cl2F2N2O3 and a molecular weight of 499.39 g/mol. Its IUPAC name is N-[[3,5-dichloro-4-(1-cyclohexylbutoxy)phenyl]carbamoyl]-2,6-difluorobenzamide.
| Compound Name | N-[[3,5-dichloro-4-(1-cyclohexylbutoxy)phenyl]carbamoyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 21285673 |
| Molecular Formula | C24H26Cl2F2N2O3 |
| Molecular Weight | 499.39 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | N-[[3,5-dichloro-4-(1-cyclohexylbutoxy)phenyl]carbamoyl]-2,6-difluorobenzamide |
| SMILES | CCCC(Oc1c(Cl)cc(NC(=O)NC(=O)c2c(F)cccc2F)cc1Cl)C1CCCCC1 |
| InChI | InChI=1S/C24H26Cl2F2N2O3/c1-2-7-20(14-8-4-3-5-9-14)33-22-16(25)12-15(13-17(22)26)29-24(32)30-23(31)21-18(27)10-6-11-19(21)28/h6,10-14,20H,2-5,7-9H2,1H3,(H2,29,30,31,32) |
| InChIKey | XPCCADRCGYFOST-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.39 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |