C26H15Cl2F2N3O5 — CID 19072689
N-[[3,5-dichloro-4-(4-nitro-2-phenylphenoxy)phenyl]carbamoyl]-2,6-difluorobenzamide (PubChem CID 19072689) has the molecular formula C26H15Cl2F2N3O5 and a molecular weight of 558.32 g/mol. Its IUPAC name is N-[[3,5-dichloro-4-(4-nitro-2-phenylphenoxy)phenyl]carbamoyl]-2,6-difluorobenzamide.
| Compound Name | N-[[3,5-dichloro-4-(4-nitro-2-phenylphenoxy)phenyl]carbamoyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 19072689 |
| Molecular Formula | C26H15Cl2F2N3O5 |
| Molecular Weight | 558.32 g/mol |
| Exact Mass | 557.04 |
| IUPAC Name | N-[[3,5-dichloro-4-(4-nitro-2-phenylphenoxy)phenyl]carbamoyl]-2,6-difluorobenzamide |
| SMILES | O=C(NC(=O)c1c(F)cccc1F)Nc1cc(Cl)c(Oc2ccc([N+](=O)[O-])cc2-c2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C26H15Cl2F2N3O5/c27-18-11-15(31-26(35)32-25(34)23-20(29)7-4-8-21(23)30)12-19(28)24(18)38-22-10-9-16(33(36)37)13-17(22)14-5-2-1-3-6-14/h1-13H,(H2,31,32,34,35) |
| InChIKey | FPISDESLKMCHFB-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.32 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|