C27H16Cl4N2O5 — CID 19072682
4-[2,6-dichloro-4-[(2,6-dichlorobenzoyl)carbamoylamino]phenoxy]-3-phenylbenzoic acid (PubChem CID 19072682) has the molecular formula C27H16Cl4N2O5 and a molecular weight of 590.25 g/mol. Its IUPAC name is 4-[2,6-dichloro-4-[(2,6-dichlorobenzoyl)carbamoylamino]phenoxy]-3-phenylbenzoic acid.
| Compound Name | 4-[2,6-dichloro-4-[(2,6-dichlorobenzoyl)carbamoylamino]phenoxy]-3-phenylbenzoic acid |
|---|---|
| PubChem CID | 19072682 |
| Molecular Formula | C27H16Cl4N2O5 |
| Molecular Weight | 590.25 g/mol |
| Exact Mass | 587.98 |
| IUPAC Name | 4-[2,6-dichloro-4-[(2,6-dichlorobenzoyl)carbamoylamino]phenoxy]-3-phenylbenzoic acid |
| SMILES | O=C(NC(=O)c1c(Cl)cccc1Cl)Nc1cc(Cl)c(Oc2ccc(C(=O)O)cc2-c2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C27H16Cl4N2O5/c28-18-7-4-8-19(29)23(18)25(34)33-27(37)32-16-12-20(30)24(21(31)13-16)38-22-10-9-15(26(35)36)11-17(22)14-5-2-1-3-6-14/h1-13H,(H,35,36)(H2,32,33,34,37) |
| InChIKey | DXRFNPSZOIYANY-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.25 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |