C23H12Cl5N3O3 — CID 19073020
2,4-dichloro-N-[[3,5-dichloro-4-(4-chloronaphthalen-1-yl)oxyphenyl]carbamoyl]pyridine-3-carboxamide (PubChem CID 19073020) has the molecular formula C23H12Cl5N3O3 and a molecular weight of 555.63 g/mol. Its IUPAC name is 2,4-dichloro-N-[[3,5-dichloro-4-(4-chloronaphthalen-1-yl)oxyphenyl]carbamoyl]pyridine-3-carboxamide.
| Compound Name | 2,4-dichloro-N-[[3,5-dichloro-4-(4-chloronaphthalen-1-yl)oxyphenyl]carbamoyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 19073020 |
| Molecular Formula | C23H12Cl5N3O3 |
| Molecular Weight | 555.63 g/mol |
| Exact Mass | 552.93 |
| IUPAC Name | 2,4-dichloro-N-[[3,5-dichloro-4-(4-chloronaphthalen-1-yl)oxyphenyl]carbamoyl]pyridine-3-carboxamide |
| SMILES | O=C(NC(=O)c1c(Cl)ccnc1Cl)Nc1cc(Cl)c(Oc2ccc(Cl)c3ccccc23)c(Cl)c1 |
| InChI | InChI=1S/C23H12Cl5N3O3/c24-14-5-6-18(13-4-2-1-3-12(13)14)34-20-16(26)9-11(10-17(20)27)30-23(33)31-22(32)19-15(25)7-8-29-21(19)28/h1-10H,(H2,30,31,32,33) |
| InChIKey | XTYXMYPKHZCJSH-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.63 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|