C21H17Cl2N3O5 — CID 12912829
N-[[6-(2,6-dichlorophenoxy)-3-pyridinyl]carbamoyl]-2,6-dimethoxybenzamide (PubChem CID 12912829) has the molecular formula C21H17Cl2N3O5 and a molecular weight of 462.29 g/mol. Its IUPAC name is N-[[6-(2,6-dichlorophenoxy)-3-pyridinyl]carbamoyl]-2,6-dimethoxybenzamide.
| Compound Name | N-[[6-(2,6-dichlorophenoxy)-3-pyridinyl]carbamoyl]-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 12912829 |
| Molecular Formula | C21H17Cl2N3O5 |
| Molecular Weight | 462.29 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | N-[[6-(2,6-dichlorophenoxy)-3-pyridinyl]carbamoyl]-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)NC(=O)Nc1ccc(Oc2c(Cl)cccc2Cl)nc1 |
| InChI | InChI=1S/C21H17Cl2N3O5/c1-29-15-7-4-8-16(30-2)18(15)20(27)26-21(28)25-12-9-10-17(24-11-12)31-19-13(22)5-3-6-14(19)23/h3-11H,1-2H3,(H2,25,26,27,28) |
| InChIKey | BSMSTQGLDBTUIH-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.29 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |