C19H13Cl2N3O2 — CID 13242737
2,6-dichloro-N-[(6-phenyl-3-pyridinyl)carbamoyl]benzamide (PubChem CID 13242737) has the molecular formula C19H13Cl2N3O2 and a molecular weight of 386.24 g/mol. Its IUPAC name is 2,6-dichloro-N-[(6-phenyl-3-pyridinyl)carbamoyl]benzamide.
| Compound Name | 2,6-dichloro-N-[(6-phenyl-3-pyridinyl)carbamoyl]benzamide |
|---|---|
| PubChem CID | 13242737 |
| Molecular Formula | C19H13Cl2N3O2 |
| Molecular Weight | 386.24 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | 2,6-dichloro-N-[(6-phenyl-3-pyridinyl)carbamoyl]benzamide |
| SMILES | O=C(NC(=O)c1c(Cl)cccc1Cl)Nc1ccc(-c2ccccc2)nc1 |
| InChI | InChI=1S/C19H13Cl2N3O2/c20-14-7-4-8-15(21)17(14)18(25)24-19(26)23-13-9-10-16(22-11-13)12-5-2-1-3-6-12/h1-11H,(H2,23,24,25,26) |
| InChIKey | XHAVMCFXECYBRO-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.24 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |