C17H12Cl4N2O2 — CID 19006403
2,6-dichloro-N-[[4-(2,3-dichlorocyclopropyl)phenyl]carbamoyl]benzamide (PubChem CID 19006403) has the molecular formula C17H12Cl4N2O2 and a molecular weight of 418.11 g/mol. Its IUPAC name is 2,6-dichloro-N-[[4-(2,3-dichlorocyclopropyl)phenyl]carbamoyl]benzamide.
| Compound Name | 2,6-dichloro-N-[[4-(2,3-dichlorocyclopropyl)phenyl]carbamoyl]benzamide |
|---|---|
| PubChem CID | 19006403 |
| Molecular Formula | C17H12Cl4N2O2 |
| Molecular Weight | 418.11 g/mol |
| Exact Mass | 415.97 |
| IUPAC Name | 2,6-dichloro-N-[[4-(2,3-dichlorocyclopropyl)phenyl]carbamoyl]benzamide |
| SMILES | O=C(NC(=O)c1c(Cl)cccc1Cl)Nc1ccc(C2C(Cl)C2Cl)cc1 |
| InChI | InChI=1S/C17H12Cl4N2O2/c18-10-2-1-3-11(19)13(10)16(24)23-17(25)22-9-6-4-8(5-7-9)12-14(20)15(12)21/h1-7,12,14-15H,(H2,22,23,24,25) |
| InChIKey | WNAPNARRIRXRRI-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.11 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|