C15H11Cl3N2O4S — CID 22614284
2,6-dichloro-N-[(3-chloro-4-methylsulfonylphenyl)carbamoyl]benzamide (PubChem CID 22614284) has the molecular formula C15H11Cl3N2O4S and a molecular weight of 421.69 g/mol. Its IUPAC name is 2,6-dichloro-N-[(3-chloro-4-methylsulfonylphenyl)carbamoyl]benzamide.
| Compound Name | 2,6-dichloro-N-[(3-chloro-4-methylsulfonylphenyl)carbamoyl]benzamide |
|---|---|
| PubChem CID | 22614284 |
| Molecular Formula | C15H11Cl3N2O4S |
| Molecular Weight | 421.69 g/mol |
| Exact Mass | 419.95 |
| IUPAC Name | 2,6-dichloro-N-[(3-chloro-4-methylsulfonylphenyl)carbamoyl]benzamide |
| SMILES | CS(=O)(=O)c1ccc(NC(=O)NC(=O)c2c(Cl)cccc2Cl)cc1Cl |
| InChI | InChI=1S/C15H11Cl3N2O4S/c1-25(23,24)12-6-5-8(7-11(12)18)19-15(22)20-14(21)13-9(16)3-2-4-10(13)17/h2-7H,1H3,(H2,19,20,21,22) |
| InChIKey | FXBHJNCGSWPLTC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.69 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |