C17H17ClF2N2O3S — CID 97259057
1-[(1S)-1-(2-chlorophenyl)ethyl]-3-[3-(difluoromethyl)-4-methylsulfonylphenyl]urea (PubChem CID 97259057) has the molecular formula C17H17ClF2N2O3S and a molecular weight of 402.85 g/mol. Its IUPAC name is 1-[(1S)-1-(2-chlorophenyl)ethyl]-3-[3-(difluoromethyl)-4-methylsulfonylphenyl]urea.
| Compound Name | 1-[(1S)-1-(2-chlorophenyl)ethyl]-3-[3-(difluoromethyl)-4-methylsulfonylphenyl]urea |
|---|---|
| PubChem CID | 97259057 |
| Molecular Formula | C17H17ClF2N2O3S |
| Molecular Weight | 402.85 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | 1-[(1S)-1-(2-chlorophenyl)ethyl]-3-[3-(difluoromethyl)-4-methylsulfonylphenyl]urea |
| SMILES | C[C@H](NC(=O)Nc1ccc(S(C)(=O)=O)c(C(F)F)c1)c1ccccc1Cl |
| InChI | InChI=1S/C17H17ClF2N2O3S/c1-10(12-5-3-4-6-14(12)18)21-17(23)22-11-7-8-15(26(2,24)25)13(9-11)16(19)20/h3-10,16H,1-2H3,(H2,21,22,23)/t10-/m0/s1 |
| InChIKey | YEMHMDRTCWOVGT-JTQLQIEISA-N |
| XLogP | 4.56 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.85 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |