C17H20ClN3O4S — CID 55699083
1-[1-(2-chlorophenyl)ethyl]-3-[4-[methoxy(methyl)sulfamoyl]phenyl]urea (PubChem CID 55699083) has the molecular formula C17H20ClN3O4S and a molecular weight of 397.88 g/mol. Its IUPAC name is 1-[1-(2-chlorophenyl)ethyl]-3-[4-[methoxy(methyl)sulfamoyl]phenyl]urea.
| Compound Name | 1-[1-(2-chlorophenyl)ethyl]-3-[4-[methoxy(methyl)sulfamoyl]phenyl]urea |
|---|---|
| PubChem CID | 55699083 |
| Molecular Formula | C17H20ClN3O4S |
| Molecular Weight | 397.88 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | 1-[1-(2-chlorophenyl)ethyl]-3-[4-[methoxy(methyl)sulfamoyl]phenyl]urea |
| SMILES | CON(C)S(=O)(=O)c1ccc(NC(=O)NC(C)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C17H20ClN3O4S/c1-12(15-6-4-5-7-16(15)18)19-17(22)20-13-8-10-14(11-9-13)26(23,24)21(2)25-3/h4-12H,1-3H3,(H2,19,20,22) |
| InChIKey | MWQQAQCTEASUOL-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.88 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|