C21H28ClN3O3S — CID 55473706
1-[1-(2-chlorophenyl)ethyl]-3-[1-[4-(diethylsulfamoyl)phenyl]ethyl]urea (PubChem CID 55473706) has the molecular formula C21H28ClN3O3S and a molecular weight of 437.99 g/mol. Its IUPAC name is 1-[1-(2-chlorophenyl)ethyl]-3-[1-[4-(diethylsulfamoyl)phenyl]ethyl]urea.
| Compound Name | 1-[1-(2-chlorophenyl)ethyl]-3-[1-[4-(diethylsulfamoyl)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 55473706 |
| Molecular Formula | C21H28ClN3O3S |
| Molecular Weight | 437.99 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 1-[1-(2-chlorophenyl)ethyl]-3-[1-[4-(diethylsulfamoyl)phenyl]ethyl]urea |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(C)NC(=O)NC(C)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C21H28ClN3O3S/c1-5-25(6-2)29(27,28)18-13-11-17(12-14-18)15(3)23-21(26)24-16(4)19-9-7-8-10-20(19)22/h7-16H,5-6H2,1-4H3,(H2,23,24,26) |
| InChIKey | RKHANHGRJMPEDG-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.99 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |