C25H38N4O3S — CID 52525151
1-[[2-(diethylaminomethyl)phenyl]methyl]-3-[(1S)-1-[4-(diethylsulfamoyl)phenyl]ethyl]urea (PubChem CID 52525151) has the molecular formula C25H38N4O3S and a molecular weight of 474.67 g/mol. Its IUPAC name is 1-[[2-(diethylaminomethyl)phenyl]methyl]-3-[(1S)-1-[4-(diethylsulfamoyl)phenyl]ethyl]urea.
| Compound Name | 1-[[2-(diethylaminomethyl)phenyl]methyl]-3-[(1S)-1-[4-(diethylsulfamoyl)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 52525151 |
| Molecular Formula | C25H38N4O3S |
| Molecular Weight | 474.67 g/mol |
| Exact Mass | 474.27 |
| IUPAC Name | 1-[[2-(diethylaminomethyl)phenyl]methyl]-3-[(1S)-1-[4-(diethylsulfamoyl)phenyl]ethyl]urea |
| SMILES | CCN(CC)Cc1ccccc1CNC(=O)N[C@@H](C)c1ccc(S(=O)(=O)N(CC)CC)cc1 |
| InChI | InChI=1S/C25H38N4O3S/c1-6-28(7-2)19-23-13-11-10-12-22(23)18-26-25(30)27-20(5)21-14-16-24(17-15-21)33(31,32)29(8-3)9-4/h10-17,20H,6-9,18-19H2,1-5H3,(H2,26,27,30)/t20-/m0/s1 |
| InChIKey | FWLYSATVWAQMKT-FQEVSTJZSA-N |
| XLogP | 4.12 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.67 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |