C24H29N3O3S — CID 46486352
1-[[4-(diethylsulfamoyl)phenyl]methyl]-3-(1-naphthalen-2-ylethyl)urea (PubChem CID 46486352) has the molecular formula C24H29N3O3S and a molecular weight of 439.58 g/mol. Its IUPAC name is 1-[[4-(diethylsulfamoyl)phenyl]methyl]-3-(1-naphthalen-2-ylethyl)urea.
| Compound Name | 1-[[4-(diethylsulfamoyl)phenyl]methyl]-3-(1-naphthalen-2-ylethyl)urea |
|---|---|
| PubChem CID | 46486352 |
| Molecular Formula | C24H29N3O3S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 1-[[4-(diethylsulfamoyl)phenyl]methyl]-3-(1-naphthalen-2-ylethyl)urea |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(CNC(=O)NC(C)c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C24H29N3O3S/c1-4-27(5-2)31(29,30)23-14-10-19(11-15-23)17-25-24(28)26-18(3)21-13-12-20-8-6-7-9-22(20)16-21/h6-16,18H,4-5,17H2,1-3H3,(H2,25,26,28) |
| InChIKey | KSKAOZREEMTEAK-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |