C25H37N5O3S — CID 55741523
1-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-3-[1-[4-(diethylsulfamoyl)phenyl]ethyl]urea (PubChem CID 55741523) has the molecular formula C25H37N5O3S and a molecular weight of 487.67 g/mol. Its IUPAC name is 1-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-3-[1-[4-(diethylsulfamoyl)phenyl]ethyl]urea.
| Compound Name | 1-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-3-[1-[4-(diethylsulfamoyl)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 55741523 |
| Molecular Formula | C25H37N5O3S |
| Molecular Weight | 487.67 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | 1-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-3-[1-[4-(diethylsulfamoyl)phenyl]ethyl]urea |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(C)NC(=O)NCc2ccc(N3CCCCCC3)nc2)cc1 |
| InChI | InChI=1S/C25H37N5O3S/c1-4-30(5-2)34(32,33)23-13-11-22(12-14-23)20(3)28-25(31)27-19-21-10-15-24(26-18-21)29-16-8-6-7-9-17-29/h10-15,18,20H,4-9,16-17,19H2,1-3H3,(H2,27,28,31) |
| InChIKey | JCKYALGWFBFHCF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.67 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |