C21H30N4O5S2 — CID 16608992
1-[1-[4-(diethylsulfamoyl)phenyl]ethyl]-3-[[3-(methanesulfonamido)phenyl]methyl]urea (PubChem CID 16608992) has the molecular formula C21H30N4O5S2 and a molecular weight of 482.63 g/mol. Its IUPAC name is 1-[1-[4-(diethylsulfamoyl)phenyl]ethyl]-3-[[3-(methanesulfonamido)phenyl]methyl]urea.
| Compound Name | 1-[1-[4-(diethylsulfamoyl)phenyl]ethyl]-3-[[3-(methanesulfonamido)phenyl]methyl]urea |
|---|---|
| PubChem CID | 16608992 |
| Molecular Formula | C21H30N4O5S2 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | 1-[1-[4-(diethylsulfamoyl)phenyl]ethyl]-3-[[3-(methanesulfonamido)phenyl]methyl]urea |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(C)NC(=O)NCc2cccc(NS(C)(=O)=O)c2)cc1 |
| InChI | InChI=1S/C21H30N4O5S2/c1-5-25(6-2)32(29,30)20-12-10-18(11-13-20)16(3)23-21(26)22-15-17-8-7-9-19(14-17)24-31(4,27)28/h7-14,16,24H,5-6,15H2,1-4H3,(H2,22,23,26) |
| InChIKey | XLFHOZOPQXZJLY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |