C14H23N3O3S — CID 41465627
1-[[3-(methanesulfonamido)phenyl]methyl]-3-(3-methylbutyl)urea (PubChem CID 41465627) has the molecular formula C14H23N3O3S and a molecular weight of 313.42 g/mol. Its IUPAC name is 1-[[3-(methanesulfonamido)phenyl]methyl]-3-(3-methylbutyl)urea.
| Compound Name | 1-[[3-(methanesulfonamido)phenyl]methyl]-3-(3-methylbutyl)urea |
|---|---|
| PubChem CID | 41465627 |
| Molecular Formula | C14H23N3O3S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 1-[[3-(methanesulfonamido)phenyl]methyl]-3-(3-methylbutyl)urea |
| SMILES | CC(C)CCNC(=O)NCc1cccc(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C14H23N3O3S/c1-11(2)7-8-15-14(18)16-10-12-5-4-6-13(9-12)17-21(3,19)20/h4-6,9,11,17H,7-8,10H2,1-3H3,(H2,15,16,18) |
| InChIKey | RSYDLWVNKIQMSL-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |