C18H20F3N5O5S — CID 16962329
1-[[3-(methanesulfonamido)phenyl]methyl]-3-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]urea (PubChem CID 16962329) has the molecular formula C18H20F3N5O5S and a molecular weight of 475.45 g/mol. Its IUPAC name is 1-[[3-(methanesulfonamido)phenyl]methyl]-3-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]urea.
| Compound Name | 1-[[3-(methanesulfonamido)phenyl]methyl]-3-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]urea |
|---|---|
| PubChem CID | 16962329 |
| Molecular Formula | C18H20F3N5O5S |
| Molecular Weight | 475.45 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | 1-[[3-(methanesulfonamido)phenyl]methyl]-3-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]urea |
| SMILES | CS(=O)(=O)Nc1cccc(CNC(=O)NCCNc2ccc(C(F)(F)F)cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H20F3N5O5S/c1-32(30,31)25-14-4-2-3-12(9-14)11-24-17(27)23-8-7-22-15-6-5-13(18(19,20)21)10-16(15)26(28)29/h2-6,9-10,22,25H,7-8,11H2,1H3,(H2,23,24,27) |
| InChIKey | ZCYCIGUCXVKNGF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 142.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.45 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|