C16H19N3O5S — CID 38441548
N-[3-[[3-(methanesulfonamido)phenyl]methylamino]-3-oxopropyl]furan-3-carboxamide (PubChem CID 38441548) has the molecular formula C16H19N3O5S and a molecular weight of 365.41 g/mol. Its IUPAC name is N-[3-[[3-(methanesulfonamido)phenyl]methylamino]-3-oxopropyl]furan-3-carboxamide.
| Compound Name | N-[3-[[3-(methanesulfonamido)phenyl]methylamino]-3-oxopropyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 38441548 |
| Molecular Formula | C16H19N3O5S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | N-[3-[[3-(methanesulfonamido)phenyl]methylamino]-3-oxopropyl]furan-3-carboxamide |
| SMILES | CS(=O)(=O)Nc1cccc(CNC(=O)CCNC(=O)c2ccoc2)c1 |
| InChI | InChI=1S/C16H19N3O5S/c1-25(22,23)19-14-4-2-3-12(9-14)10-18-15(20)5-7-17-16(21)13-6-8-24-11-13/h2-4,6,8-9,11,19H,5,7,10H2,1H3,(H,17,21)(H,18,20) |
| InChIKey | KKKXKYICEWUMMJ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 117.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |