C17H21N3O4S — CID 16608876
1-[[3-(methanesulfonamido)phenyl]methyl]-3-[(3-methoxyphenyl)methyl]urea (PubChem CID 16608876) has the molecular formula C17H21N3O4S and a molecular weight of 363.44 g/mol. Its IUPAC name is 1-[[3-(methanesulfonamido)phenyl]methyl]-3-[(3-methoxyphenyl)methyl]urea.
| Compound Name | 1-[[3-(methanesulfonamido)phenyl]methyl]-3-[(3-methoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 16608876 |
| Molecular Formula | C17H21N3O4S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 1-[[3-(methanesulfonamido)phenyl]methyl]-3-[(3-methoxyphenyl)methyl]urea |
| SMILES | COc1cccc(CNC(=O)NCc2cccc(NS(C)(=O)=O)c2)c1 |
| InChI | InChI=1S/C17H21N3O4S/c1-24-16-8-4-6-14(10-16)12-19-17(21)18-11-13-5-3-7-15(9-13)20-25(2,22)23/h3-10,20H,11-12H2,1-2H3,(H2,18,19,21) |
| InChIKey | VLYHWYPIWPCJMK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |