C25H37N3O3S — CID 31640298
N-[[2-(diethylaminomethyl)phenyl]methyl]-3-[4-(diethylsulfamoyl)phenyl]propanamide (PubChem CID 31640298) has the molecular formula C25H37N3O3S and a molecular weight of 459.66 g/mol. Its IUPAC name is N-[[2-(diethylaminomethyl)phenyl]methyl]-3-[4-(diethylsulfamoyl)phenyl]propanamide.
| Compound Name | N-[[2-(diethylaminomethyl)phenyl]methyl]-3-[4-(diethylsulfamoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 31640298 |
| Molecular Formula | C25H37N3O3S |
| Molecular Weight | 459.66 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | N-[[2-(diethylaminomethyl)phenyl]methyl]-3-[4-(diethylsulfamoyl)phenyl]propanamide |
| SMILES | CCN(CC)Cc1ccccc1CNC(=O)CCc1ccc(S(=O)(=O)N(CC)CC)cc1 |
| InChI | InChI=1S/C25H37N3O3S/c1-5-27(6-2)20-23-12-10-9-11-22(23)19-26-25(29)18-15-21-13-16-24(17-14-21)32(30,31)28(7-3)8-4/h9-14,16-17H,5-8,15,18-20H2,1-4H3,(H,26,29) |
| InChIKey | VVNULHSOHGVNDR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.66 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |