C22H27FN2O5S — CID 35380229
[2-[(2-fluorophenyl)methylamino]-2-oxoethyl] 3-[4-(diethylsulfamoyl)phenyl]propanoate (PubChem CID 35380229) has the molecular formula C22H27FN2O5S and a molecular weight of 450.53 g/mol. Its IUPAC name is [2-[(2-fluorophenyl)methylamino]-2-oxoethyl] 3-[4-(diethylsulfamoyl)phenyl]propanoate.
| Compound Name | [2-[(2-fluorophenyl)methylamino]-2-oxoethyl] 3-[4-(diethylsulfamoyl)phenyl]propanoate |
|---|---|
| PubChem CID | 35380229 |
| Molecular Formula | C22H27FN2O5S |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | [2-[(2-fluorophenyl)methylamino]-2-oxoethyl] 3-[4-(diethylsulfamoyl)phenyl]propanoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(CCC(=O)OCC(=O)NCc2ccccc2F)cc1 |
| InChI | InChI=1S/C22H27FN2O5S/c1-3-25(4-2)31(28,29)19-12-9-17(10-13-19)11-14-22(27)30-16-21(26)24-15-18-7-5-6-8-20(18)23/h5-10,12-13H,3-4,11,14-16H2,1-2H3,(H,24,26) |
| InChIKey | COVUVDIBEQCGEE-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |