C20H24ClN3O5S — CID 46609829
[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 3-[4-(diethylsulfamoyl)phenyl]propanoate (PubChem CID 46609829) has the molecular formula C20H24ClN3O5S and a molecular weight of 453.95 g/mol. Its IUPAC name is [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 3-[4-(diethylsulfamoyl)phenyl]propanoate.
| Compound Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 3-[4-(diethylsulfamoyl)phenyl]propanoate |
|---|---|
| PubChem CID | 46609829 |
| Molecular Formula | C20H24ClN3O5S |
| Molecular Weight | 453.95 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 3-[4-(diethylsulfamoyl)phenyl]propanoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(CCC(=O)OCC(=O)Nc2ccc(Cl)cn2)cc1 |
| InChI | InChI=1S/C20H24ClN3O5S/c1-3-24(4-2)30(27,28)17-9-5-15(6-10-17)7-12-20(26)29-14-19(25)23-18-11-8-16(21)13-22-18/h5-6,8-11,13H,3-4,7,12,14H2,1-2H3,(H,22,23,25) |
| InChIKey | XWLUUBFDDVSCJQ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.95 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |