C19H33N3O3S — CID 55393884
N-[2-(diethylamino)ethyl]-3-[4-(diethylsulfamoyl)phenyl]propanamide (PubChem CID 55393884) has the molecular formula C19H33N3O3S and a molecular weight of 383.56 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-3-[4-(diethylsulfamoyl)phenyl]propanamide.
| Compound Name | N-[2-(diethylamino)ethyl]-3-[4-(diethylsulfamoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 55393884 |
| Molecular Formula | C19H33N3O3S |
| Molecular Weight | 383.56 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-3-[4-(diethylsulfamoyl)phenyl]propanamide |
| SMILES | CCN(CC)CCNC(=O)CCc1ccc(S(=O)(=O)N(CC)CC)cc1 |
| InChI | InChI=1S/C19H33N3O3S/c1-5-21(6-2)16-15-20-19(23)14-11-17-9-12-18(13-10-17)26(24,25)22(7-3)8-4/h9-10,12-13H,5-8,11,14-16H2,1-4H3,(H,20,23) |
| InChIKey | PIOUKWYLPCTYDX-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.56 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |