C18H32ClN3O3S — CID 120654006
3-[4-(diethylsulfamoyl)phenyl]-N-[(2R)-2-(ethylamino)propyl]propanamide;hydrochloride (PubChem CID 120654006) has the molecular formula C18H32ClN3O3S and a molecular weight of 405.99 g/mol. Its IUPAC name is 3-[4-(diethylsulfamoyl)phenyl]-N-[(2R)-2-(ethylamino)propyl]propanamide;hydrochloride.
| Compound Name | 3-[4-(diethylsulfamoyl)phenyl]-N-[(2R)-2-(ethylamino)propyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 120654006 |
| Molecular Formula | C18H32ClN3O3S |
| Molecular Weight | 405.99 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 3-[4-(diethylsulfamoyl)phenyl]-N-[(2R)-2-(ethylamino)propyl]propanamide;hydrochloride |
| SMILES | CCN[C@H](C)CNC(=O)CCc1ccc(S(=O)(=O)N(CC)CC)cc1.Cl |
| InChI | InChI=1S/C18H31N3O3S.ClH/c1-5-19-15(4)14-20-18(22)13-10-16-8-11-17(12-9-16)25(23,24)21(6-2)7-3;/h8-9,11-12,15,19H,5-7,10,13-14H2,1-4H3,(H,20,22);1H/t15-;/m1./s1 |
| InChIKey | JVFVWTWZHBIICX-XFULWGLBSA-N |
| XLogP | 2.19 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.99 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |