C17H29N3O3S — CID 120828761
3-[4-(diethylsulfamoyl)phenyl]-N-[2-(methylamino)propyl]propanamide (PubChem CID 120828761) has the molecular formula C17H29N3O3S and a molecular weight of 355.50 g/mol. Its IUPAC name is 3-[4-(diethylsulfamoyl)phenyl]-N-[2-(methylamino)propyl]propanamide.
| Compound Name | 3-[4-(diethylsulfamoyl)phenyl]-N-[2-(methylamino)propyl]propanamide |
|---|---|
| PubChem CID | 120828761 |
| Molecular Formula | C17H29N3O3S |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 3-[4-(diethylsulfamoyl)phenyl]-N-[2-(methylamino)propyl]propanamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(CCC(=O)NCC(C)NC)cc1 |
| InChI | InChI=1S/C17H29N3O3S/c1-5-20(6-2)24(22,23)16-10-7-15(8-11-16)9-12-17(21)19-13-14(3)18-4/h7-8,10-11,14,18H,5-6,9,12-13H2,1-4H3,(H,19,21) |
| InChIKey | AKGIDHWJBZJHEE-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |