C18H30N2O3S — CID 51211052
3-[4-(diethylsulfamoyl)phenyl]-N-(2-methylbutan-2-yl)propanamide (PubChem CID 51211052) has the molecular formula C18H30N2O3S and a molecular weight of 354.52 g/mol. Its IUPAC name is 3-[4-(diethylsulfamoyl)phenyl]-N-(2-methylbutan-2-yl)propanamide.
| Compound Name | 3-[4-(diethylsulfamoyl)phenyl]-N-(2-methylbutan-2-yl)propanamide |
|---|---|
| PubChem CID | 51211052 |
| Molecular Formula | C18H30N2O3S |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | 3-[4-(diethylsulfamoyl)phenyl]-N-(2-methylbutan-2-yl)propanamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(CCC(=O)NC(C)(C)CC)cc1 |
| InChI | InChI=1S/C18H30N2O3S/c1-6-18(4,5)19-17(21)14-11-15-9-12-16(13-10-15)24(22,23)20(7-2)8-3/h9-10,12-13H,6-8,11,14H2,1-5H3,(H,19,21) |
| InChIKey | DGVDNTNRQXGNGM-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |