C20H25N5O3S — CID 41482598
1-(benzimidazol-1-yl)-3-[(1S)-1-[4-(diethylsulfamoyl)phenyl]ethyl]urea (PubChem CID 41482598) has the molecular formula C20H25N5O3S and a molecular weight of 415.52 g/mol. Its IUPAC name is 1-(benzimidazol-1-yl)-3-[(1S)-1-[4-(diethylsulfamoyl)phenyl]ethyl]urea.
| Compound Name | 1-(benzimidazol-1-yl)-3-[(1S)-1-[4-(diethylsulfamoyl)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 41482598 |
| Molecular Formula | C20H25N5O3S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 1-(benzimidazol-1-yl)-3-[(1S)-1-[4-(diethylsulfamoyl)phenyl]ethyl]urea |
| SMILES | CCN(CC)S(=O)(=O)c1ccc([C@H](C)NC(=O)Nn2cnc3ccccc32)cc1 |
| InChI | InChI=1S/C20H25N5O3S/c1-4-24(5-2)29(27,28)17-12-10-16(11-13-17)15(3)22-20(26)23-25-14-21-18-8-6-7-9-19(18)25/h6-15H,4-5H2,1-3H3,(H2,22,23,26)/t15-/m0/s1 |
| InChIKey | YLUUZIUHFJMMRP-HNNXBMFYSA-N |
| XLogP | 3.08 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |