C17H29N3O4S — CID 51118606
3-[4-[methoxy(methyl)sulfamoyl]phenyl]-1,1-bis(2-methylpropyl)urea (PubChem CID 51118606) has the molecular formula C17H29N3O4S and a molecular weight of 371.50 g/mol. Its IUPAC name is 3-[4-[methoxy(methyl)sulfamoyl]phenyl]-1,1-bis(2-methylpropyl)urea.
| Compound Name | 3-[4-[methoxy(methyl)sulfamoyl]phenyl]-1,1-bis(2-methylpropyl)urea |
|---|---|
| PubChem CID | 51118606 |
| Molecular Formula | C17H29N3O4S |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | 3-[4-[methoxy(methyl)sulfamoyl]phenyl]-1,1-bis(2-methylpropyl)urea |
| SMILES | CON(C)S(=O)(=O)c1ccc(NC(=O)N(CC(C)C)CC(C)C)cc1 |
| InChI | InChI=1S/C17H29N3O4S/c1-13(2)11-20(12-14(3)4)17(21)18-15-7-9-16(10-8-15)25(22,23)19(5)24-6/h7-10,13-14H,11-12H2,1-6H3,(H,18,21) |
| InChIKey | IICZFHQITGXFIV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|