C19H27N3O — CID 108886840
1,1-bis(2-methylpropyl)-3-(4-pyrrol-1-ylphenyl)urea (PubChem CID 108886840) has the molecular formula C19H27N3O and a molecular weight of 313.44 g/mol. Its IUPAC name is 1,1-bis(2-methylpropyl)-3-(4-pyrrol-1-ylphenyl)urea.
| Compound Name | 1,1-bis(2-methylpropyl)-3-(4-pyrrol-1-ylphenyl)urea |
|---|---|
| PubChem CID | 108886840 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | 1,1-bis(2-methylpropyl)-3-(4-pyrrol-1-ylphenyl)urea |
| SMILES | CC(C)CN(CC(C)C)C(=O)Nc1ccc(-n2cccc2)cc1 |
| InChI | InChI=1S/C19H27N3O/c1-15(2)13-22(14-16(3)4)19(23)20-17-7-9-18(10-8-17)21-11-5-6-12-21/h5-12,15-16H,13-14H2,1-4H3,(H,20,23) |
| InChIKey | YAKFBKJWLBAWOR-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |