C22H23N3O4 — CID 138657696
methyl (2S)-2-amino-5-oxo-5-[4-(4-pyrrol-1-ylphenoxy)anilino]pentanoate (PubChem CID 138657696) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is methyl (2S)-2-amino-5-oxo-5-[4-(4-pyrrol-1-ylphenoxy)anilino]pentanoate.
| Compound Name | methyl (2S)-2-amino-5-oxo-5-[4-(4-pyrrol-1-ylphenoxy)anilino]pentanoate |
|---|---|
| PubChem CID | 138657696 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | methyl (2S)-2-amino-5-oxo-5-[4-(4-pyrrol-1-ylphenoxy)anilino]pentanoate |
| SMILES | COC(=O)[C@@H](N)CCC(=O)Nc1ccc(Oc2ccc(-n3cccc3)cc2)cc1 |
| InChI | InChI=1S/C22H23N3O4/c1-28-22(27)20(23)12-13-21(26)24-16-4-8-18(9-5-16)29-19-10-6-17(7-11-19)25-14-2-3-15-25/h2-11,14-15,20H,12-13,23H2,1H3,(H,24,26)/t20-/m0/s1 |
| InChIKey | XNQHFTPINLWFIU-FQEVSTJZSA-N |
| XLogP | 3.49 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |