C21H21N3O4 — CID 74349720
2-amino-N'-[4-[4-(furan-3-yl)phenoxy]phenyl]pentanediamide (PubChem CID 74349720) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is 2-amino-N'-[4-[4-(furan-3-yl)phenoxy]phenyl]pentanediamide.
| Compound Name | 2-amino-N'-[4-[4-(furan-3-yl)phenoxy]phenyl]pentanediamide |
|---|---|
| PubChem CID | 74349720 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 2-amino-N'-[4-[4-(furan-3-yl)phenoxy]phenyl]pentanediamide |
| SMILES | NC(=O)C(N)CCC(=O)Nc1ccc(Oc2ccc(-c3ccoc3)cc2)cc1 |
| InChI | InChI=1S/C21H21N3O4/c22-19(21(23)26)9-10-20(25)24-16-3-7-18(8-4-16)28-17-5-1-14(2-6-17)15-11-12-27-13-15/h1-8,11-13,19H,9-10,22H2,(H2,23,26)(H,24,25) |
| InChIKey | LYOSKDSEWRJQAH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 120.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |