C17H21N3O2 — CID 74349728
4,5-diamino-N-(4-phenoxyphenyl)pentanamide (PubChem CID 74349728) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is 4,5-diamino-N-(4-phenoxyphenyl)pentanamide.
| Compound Name | 4,5-diamino-N-(4-phenoxyphenyl)pentanamide |
|---|---|
| PubChem CID | 74349728 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 4,5-diamino-N-(4-phenoxyphenyl)pentanamide |
| SMILES | NCC(N)CCC(=O)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C17H21N3O2/c18-12-13(19)6-11-17(21)20-14-7-9-16(10-8-14)22-15-4-2-1-3-5-15/h1-5,7-10,13H,6,11-12,18-19H2,(H,20,21) |
| InChIKey | YUSYHJFOQGXULG-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |